- 3-METHYLSTYRENE
-
- $1.00 / 1KG
-
2020-01-08
- CAS:100-80-1
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 200KG
- 3-METHYLSTYRENE
-
- $1.00 / 1KG
-
2020-01-08
- CAS:100-80-1
- Min. Order: 1KG
- Purity: 98%-99.9%
- Supply Ability: 200KG
|
| | 3-METHYLSTYRENE Basic information |
| Product Name: | 3-METHYLSTYRENE | | Synonyms: | benzene,1-ethenyl-3-methyl-;m-methyl-styren;Styrene, m-methyl-;1-ethenyl-3-methylbenzene;1-methyl-3-ethenylbenzene;1-Methyl-3-vinylbenzene;3-ethenylmethylbenzene;3-Methylstyrene, 98%, stabilized with TBC | | CAS: | 100-80-1 | | MF: | C9H10 | | MW: | 118.18 | | EINECS: | 202-889-2 | | Product Categories: | Styrenes | | Mol File: | 100-80-1.mol |  |
| | 3-METHYLSTYRENE Chemical Properties |
| Melting point | -82--81 °C (lit.) | | Boiling point | 170-171 °C (lit.) | | density | 0.89 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.541(lit.) | | Fp | 124 °F | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | Soluble in Methanol, Ether, Benzene, Acetone, Ethanol, Heptane. Soluble in water (0.09 g/L) at 20°C. | | BRN | 1304618 | | InChI | InChI=1S/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 | | InChIKey | JZHGRUMIRATHIU-UHFFFAOYSA-N | | SMILES | C1(C=C)=CC=CC(C)=C1 | | CAS DataBase Reference | 100-80-1(CAS DataBase Reference) | | EPA Substance Registry System | m-Vinyltoluene (100-80-1) |
| | 3-METHYLSTYRENE Usage And Synthesis |
| Uses | 3-Methylstyreneis used as pharmaceutical intermediates. |
| | 3-METHYLSTYRENE Preparation Products And Raw materials |
|