|
|
| | 2-Fluoro-6-methylbenzoic acid Basic information |
| | 2-Fluoro-6-methylbenzoic acid Chemical Properties |
| Melting point | 124-125° | | Boiling point | 257.7±20.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.96±0.31(Predicted) | | form | powder | | color | White | | InChI | InChI=1S/C8H7FO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) | | InChIKey | WELNSIYTQJSNRP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(C)C=CC=C1F | | CAS DataBase Reference | 90259-27-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | Hazard Note | Irritant | | HS Code | 2916399090 |
| | 2-Fluoro-6-methylbenzoic acid Usage And Synthesis |
| Uses | 2-Fluoro-6-methoxybenzoic acid is a vital pharmaceutical intermediate, such as a raw material for synthesising benzopyrrolidine drugs, which can be used as inhibitors of tumours and human immunodeficiency virus (HIV). It can also be used as a raw material for the synthesis of imidazopyridine drugs.
|
| | 2-Fluoro-6-methylbenzoic acid Preparation Products And Raw materials |
|