|
|
| | 2,6-Dimethoxybenzaldehyde Basic information |
| | 2,6-Dimethoxybenzaldehyde Chemical Properties |
| Melting point | 96-98 °C (lit.) | | Boiling point | 285 °C (lit.) | | density | 1.1708 (rough estimate) | | refractive index | 1.5500 (estimate) | | Fp | 285°C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in Methanol (almost transparency). | | form | Crystalline Powder | | color | Yellow to beige | | Sensitive | Air Sensitive | | BRN | 908138 | | InChI | InChI=1S/C9H10O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-6H,1-2H3 | | InChIKey | WXSGQHKHUYTJNB-UHFFFAOYSA-N | | SMILES | C(=O)C1=C(OC)C=CC=C1OC | | LogP | 1.670 (est) | | CAS DataBase Reference | 3392-97-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,6-Dimethoxybenzaldehyde Usage And Synthesis |
| Chemical Properties | yellow to beige crystalline powder | | Uses | 2,6-Dimethoxybenzaldehyde is a widely used reactant that has been used in the synthesis of thiazolidin-4-one derivatives as non-nucleoside HIV-1 reverse transcriptase inhibitors. | | Uses | 2,6-Dimethoxybenzaldehyde has been used in the preparation of 2,6-dihydroxybenzaldehyde by demethylation with AlBr3. | | General Description | Demethylation of 2,6-dimethoxybenzaldehydes with magnesium iodide etherate has been studied. |
| | 2,6-Dimethoxybenzaldehyde Preparation Products And Raw materials |
|