|
|
| | norketobemidone Basic information |
| Product Name: | norketobemidone | | Synonyms: | norketobemidone;1-[4-(3-Hydroxyphenyl)-4-piperidinyl]-1-propanone;3-(4-Propionylpiperidine-4-yl)phenol;1-[4-(3-Hydroxyphenyl)piperidin-4-yl]propan-1-one;1-Propanone, 1-[4-(3-hydroxyphenyl)-4-piperidinyl]- | | CAS: | 15847-72-0 | | MF: | C14H19NO2 | | MW: | 233.31 | | EINECS: | | | Product Categories: | | | Mol File: | 15847-72-0.mol |  |
| | norketobemidone Chemical Properties |
| Melting point | 222 °C(Solv: ethanol (64-17-5)) | | Boiling point | 402.2±45.0 °C(Predicted) | | density | 1.104±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | pKa 9.00/9.84(H2O) (Uncertain) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C14H19NO2/c1-2-13(17)14(6-8-15-9-7-14)11-4-3-5-12(16)10-11/h3-5,10,15-16H,2,6-9H2,1H3 | | InChIKey | BJTDPLRIKDSWIS-UHFFFAOYSA-N | | SMILES | N1CCC(CC1)(c2cc(ccc2)O)C(=O)CC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | norketobemidone Usage And Synthesis |
| Uses | Ketobemidone impurity C EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | norketobemidone Preparation Products And Raw materials |
|