|
|
| | BENAZEPRILAT Basic information |
| | BENAZEPRILAT Chemical Properties |
| Melting point | 270-272°C | | alpha | D -200.5° (c = 1 in 3% aqueous NH4OH) | | Boiling point | 711.3±60.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Aqueous Base (Slightly), DMSO (Slightly) | | pka | 2.17±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C22H24N2O5/c25-20(26)14-24-19-9-5-4-8-16(19)11-13-17(21(24)27)23-18(22(28)29)12-10-15-6-2-1-3-7-15/h1-9,17-18,23H,10-14H2,(H,25,26)(H,28,29)/t17-,18-/m0/s1 | | InChIKey | MADRIHWFJGRSBP-ROUUACIJSA-N | | SMILES | N1(CC(O)=O)C2=CC=CC=C2CC[C@H](N[C@H](C(O)=O)CCC2=CC=CC=C2)C1=O | | CAS DataBase Reference | 86541-78-8 |
| WGK Germany | WGK 3 | | HS Code | 2933790002 | | Storage Class | 11 - Combustible Solids |
| | BENAZEPRILAT Usage And Synthesis |
| Chemical Properties | Crystalline Solid | | Uses | Benazeprilat is a metabolite of Benazepril, which is used as an antihypertensive. | | Definition | ChEBI: A benzazepine that is 1,3,4,5-tetrahydro-2H-1-benzazepin-2-one in which the hydrogen attached to the nitrogen is replaced by a carboxy methyl group and in which the 3-pro-S hydrogen is replaced by the amino
roup of (2S)-2-amino-4-phenylbutanoic acid. An angiotensin-converting enzyme inhibitor, it is used as its monoester prodrug benazepril in the treatment of hypertension and heart failure. | | in vivo | Benazeprilat (10 mg/kg, intravenous injection) and amlodipine (0.5 mg/kg, intravenous injection) in combination produce great hypotensive effect[2].
Benazepril (0.7 mg/kg, oral) markedly influences the dynamics of systemic RAAS peptides, resulting in a substantial decrease in AII and ALD while increasing PRA and AI[3]. | Animal Model: | Male SHR (14-16 weeks of age, 250-350 g)[2]. | | Dosage: | 10 mg/kg | | Administration: | I.V; once a day for 2 days. | | Result: | Produced hypotensive effect. |
| Animal Model: | Beagle dogs (12.0-19.5 kg)[3]. | | Dosage: | 0.7 mg/kg | | Administration: | P.O, once a day for 5 days. | | Result: | Effected systemic RAAS peptides. |
|
| | BENAZEPRILAT Preparation Products And Raw materials |
|