|
|
| | 3,6-dichloropyridazin-4-amine Basic information |
| Product Name: | 3,6-dichloropyridazin-4-amine | | Synonyms: | 3,6-dichloropyridazin-4-amine;4-Amino-3,6-dihydropyridazine;3,6-Dichloro-4-Pyridazinamine;3,6-Dichloro-4-aMinopyridazine;4-Amino-3,6-dichloropyridazine 98%;4-AMino-3,6-dichloropyridazine;4-AMino-3,6-dicholropyridazine;4-PyridazinaMine, 3,6-dichloro- | | CAS: | 823-58-5 | | MF: | C4H3Cl2N3 | | MW: | 163.99 | | EINECS: | | | Product Categories: | | | Mol File: | 823-58-5.mol |  |
| | 3,6-dichloropyridazin-4-amine Chemical Properties |
| Melting point | 203 °C | | Boiling point | 363.0±37.0 °C(Predicted) | | density | 1.606±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | pka | 2.08±0.10(Predicted) | | color | Yellow-brown | | InChI | InChI=1S/C4H3Cl2N3/c5-3-1-2(7)4(6)9-8-3/h1H,(H2,7,8) | | InChIKey | HODYDVHWWMTUEL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NN=C(Cl)C=C1N |
| | 3,6-dichloropyridazin-4-amine Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 3,6-dichloropyridazin-4-amine from 3,4,6-trichloropyridazine:
Example 24A: 3,4,6-Trichloropyridazine (25 g, 136 mmol) was added to a 500 mL stainless steel pressure flask containing 14.8 N ammonium hydroxide solution (200 mL). The reaction mixture was stirred at 75°C for 16 hours. Upon completion of the reaction, the mixture was cooled to room temperature and the solid product was collected by filtration to afford 17 g (76% yield) of the target compound 3,6-dichloropyridazin-4-amine. The product characterization data were as follows: 1H NMR (400 MHz, DMSO-d6) δ ppm 7.16 (s, 2H), 6.82 (s, 1H); MS (ESI+) m/z 164 (M+H)+. | | References | [1] Journal of Organic Chemistry, 2014, vol. 79, # 21, p. 10311 - 10322
[2] Patent: US2017/15675, 2017, A1. Location in patent: Paragraph 1001
[3] Patent: US2009/163489, 2009, A1. Location in patent: Page/Page column 51
[4] Patent: US2014/349990, 2014, A1. Location in patent: Paragraph 1051; 1052
[5] Patent: WO2014/191896, 2014, A1. Location in patent: Page/Page column 217; 218 |
| | 3,6-dichloropyridazin-4-amine Preparation Products And Raw materials |
|