|
|
| | Bis(4-chlorobenzyl) azodicarboxylate Basic information |
| Product Name: | Bis(4-chlorobenzyl) azodicarboxylate | | Synonyms: | N-[(4-chlorophenyl)methoxy-oxomethyl]iminocarbamic acid (4-chlorophenyl)methyl ester;DCAD Bis(4-chlorobenzyl) azodicarboxylate;(4-chlorophenyl)methyl (NE)-N-[(4-chlorophenyl)methoxycarbonylimino]carbamate;Di-p-chlorobenzyl azodicarboxylate(DCAD);Bis(4-chlorobenzyl) azodicarboxylate;Bis(4-chlorobenzyl) azodicarboxyle;(E)-bis(4-chlorobenzyl) diazene-1,2-dicarboxylate;Di-(4-chlorobenzyl)azodicarboxylate≥ 98%(HPLC) | | CAS: | 916320-82-6 | | MF: | C16H12Cl2N2O4 | | MW: | 367.18 | | EINECS: | | | Product Categories: | | | Mol File: | 916320-82-6.mol |  |
| | Bis(4-chlorobenzyl) azodicarboxylate Chemical Properties |
| Melting point | 108-112°C | | Boiling point | 505.6±45.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | Appearance | White to yellow Solid | | InChI | InChI=1S/C16H12Cl2N2O4/c17-13-5-1-11(2-6-13)9-23-15(21)19-20-16(22)24-10-12-3-7-14(18)8-4-12/h1-8H,9-10H2 | | InChIKey | UIFGGABIJBWRMG-UHFFFAOYSA-N | | SMILES | N(C(OCC1=CC=C(Cl)C=C1)=O)=NC(OCC1=CC=C(Cl)C=C1)=O |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | Bis(4-chlorobenzyl) azodicarboxylate Usage And Synthesis |
| Chemical Properties | White crystals | | Uses | Reactant for preparation of:
- Amino thioesters via guanidine-catalyzed biomimetic enantioselective decarboxylative Mannich and amination reactions of malonic acid half thioesters
- Hydroacylation reaction of aldehydes in Ionic liquid (IL) medium
- DCAD (di-p-chlorobenzyl azodicarboxylate) for Mitsunobu coupling reactions
| | General Description | Learn More at the Professor and Product Portal of Professor Bruce Lipshutz. |
| | Bis(4-chlorobenzyl) azodicarboxylate Preparation Products And Raw materials |
|