|
|
| | TRIS(2-THIENYL)PHOSPHINE Basic information |
| | TRIS(2-THIENYL)PHOSPHINE Chemical Properties |
| Melting point | 29-30 °C | | Boiling point | 205 °C / 2mmHg | | Fp | 25 °C | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | solid | | color | White or Colorless to Orange to Green | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 203736 | | InChI | InChI=1S/C12H9PS3/c1-4-10(14-7-1)13(11-5-2-8-15-11)12-6-3-9-16-12/h1-9H | | InChIKey | KUCPTMZJPDVWJL-UHFFFAOYSA-N | | SMILES | P(C1SC=CC=1)(C1SC=CC=1)C1SC=CC=1 | | CAS DataBase Reference | 24171-89-9(CAS DataBase Reference) |
| | TRIS(2-THIENYL)PHOSPHINE Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | It employed as a intermediate for pharmaceutical and organic synthesis. |
| | TRIS(2-THIENYL)PHOSPHINE Preparation Products And Raw materials |
|