- TPPS
-
- $1.00 / 1KG
-
2024-08-17
- CAS:35218-75-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| Product Name: | TPPS | | Synonyms: | 5,10,15,20-TETRAKIS-(4-SULFONATOPHENYL)-21,23H-PORPHYRIN;tpps4;wr247188;5,10,15,20-Tetraphenyl-21H,23H-porphinetetrasulfonicacid,disulfuricacid,tetrahydrate;5,10,15,20-TETRAPHENYL-21H,23H-PORPHINETETRASULFONATEDISULFURIC ACID TETRAHYDRATE (TPPS);TPPS Hydrate (=Tetraphenylporphine Tetrasulfonic Acid) [Ultra-high sensitive spectrophotometric reagent for transition metals];TPPS (=Tetraphenylporphine tetrasulfonic acid);(PORPHINE-5,10,15,20-TETRAYL)TETRAKIS(BENZENESULFONIC ACID) | | CAS: | 35218-75-8 | | MF: | C44H30N4O12S4 | | MW: | 934.99 | | EINECS: | 213-262-8 | | Product Categories: | Analytical Chemistry;Biochemistry;Chelating Reagents;Ligands for Pharmaceutical Research;Magnetic Resonance Imaging (Chelating Reagents);Porphines;Porphyrins | | Mol File: | 35218-75-8.mol |  |
| density | 1.607±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO : 62.5 mg/mL (66.85 mM; Need ultrasonic) | | form | powder to crystal | | color | Dark blue | | BRN | 4227566 | | InChIKey | PBHVCRIXMXQXPD-LWQDQPMZSA-N | | SMILES | OS(=O)(=O)c1ccc(cc1)-c2c3ccc(n3)c(-c4ccc(cc4)S(O)(=O)=O)c5ccc([nH]5)c(-c6ccc(cc6)S(O)(=O)=O)c7ccc(n7)c(-c8ccc(cc8)S(O)(=O)=O)c9ccc2[nH]9 | | CAS DataBase Reference | 35218-75-8 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | DB7339000 | | HS Code | 2933.99.8290 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Uses | TPPS is used in the process of electrostatic layer-by-layer adsorption process for formation of dye-polyelectrolyte organized molecular assemblies, and is used as a standard method to calibrate sonochemical efficiency of an individual reaction system. | | in vivo | TPPS4 shows the highest tumor to tissue ratios after 96 hours injection with a dose dependent manner[2]. TPPS4 appears to be cleared through the kidneys and absolute concentrations there are reduced with increasing time after injection[2]. |
| | TPPS Preparation Products And Raw materials |
|