- Deoxyelephantopin
-
- $97.00 / 1mg
-
2025-12-26
- CAS:29307-03-7
- Min. Order:
- Purity: 99.71%
- Supply Ability: 10g
|
| | Deoxyelephantopin Basic information |
| Product Name: | Deoxyelephantopin | | Synonyms: | Deoxyelephantopin;2-Methylpropenoic acid (3aR,4S,9R,11E,12aR)-2,3,3a,4,5,9,10,12a-octahydro-2,7-dioxo-11-methyl-3-methylene-7H-9,6-methenofuro[2,3-f]oxacycloundecin-4-yl ester;Elephantopus carolinianus compd. B;2-Propenoic acid,2-methyl-,(3aR,4S,9R,11E,12aR)-2,3,3a,4,5,9,10,12a-octahydro-11-methyl-3-methylene-2,7-dioxo-7H-9,6-methenofuro[2,3-f]oxacycloundecin-4-ylester;NSC 259726;29307-03-7---Deoxyelephantopin;(3aR,4S,9R,11E,12aR)-11-Methyl-3-methylene-2,7-dioxo-2,3,3a,4,5,9,10,12a-octahydro-7H-6,9-(metheno)furo[2,3-f][1]oxacycloundecin-4-yl methacrylate;Deoxyelephantopin, 10 mM in DMSO | | CAS: | 29307-03-7 | | MF: | C19H20O6 | | MW: | 344.36 | | EINECS: | | | Product Categories: | | | Mol File: | 29307-03-7.mol |  |
| | Deoxyelephantopin Chemical Properties |
| Melting point | 198-200 °C | | Boiling point | 584.3±50.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C19H20O6/c1-9(2)17(20)24-15-8-12-7-13(23-19(12)22)5-10(3)6-14-16(15)11(4)18(21)25-14/h6-7,13-16H,1,4-5,8H2,2-3H3/b10-6+/t13-,14-,15+,16+/m1/s1 | | InChIKey | JMUOPRSXUVOHFE-GZZMZBIISA-N | | SMILES | C(O[C@H]1CC2=C[C@@]([H])(CC(C)=C[C@@]3([H])OC(=O)C(=C)[C@@]31[H])OC2=O)(=O)C(C)=C |t:10| |
| | Deoxyelephantopin Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents, derived from Elephantopus scaber. | | Uses | Deoxydibilirubin has significant anticancer activity. | | Definition | ChEBI: Isodeoxyelephantopin is a terpene lactone. | | Biological Activity | Deoxyelephantopin is a biologically active natural sesquiterpene lactone from Elephantopus scaber. Can be widely used in cancer research. It inhibits NF-κB, MAPK, PI3K/Akt and β-catenin signaling. | | target | |
| | Deoxyelephantopin Preparation Products And Raw materials |
|