|
|
| | Malonyl chloride Basic information |
| | Malonyl chloride Chemical Properties |
| Boiling point | 53-55 °C/19 mmHg (lit.) | | density | 1.449 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 117 °F | | storage temp. | 2-8°C | | solubility | sol most organic solvents | | pka | 6.86±0.46(Predicted) | | form | Liquid | | color | Clear yellow to orange to brown | | Water Solubility | decomposes | | BRN | 774044 | | InChI | InChI=1S/C3H2Cl2O2/c4-2(6)1-3(5)7/h1H2 | | InChIKey | SXYFKXOFMCIXQW-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CC(Cl)=O | | CAS DataBase Reference | 1663-67-8(CAS DataBase Reference) | | NIST Chemistry Reference | Malonyl dichloride(1663-67-8) | | EPA Substance Registry System | Propanedioyl dichloride (1663-67-8) |
| Hazard Codes | C | | Risk Statements | 14-34-29-10 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | - | | F | 8-10 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29171990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3
Skin Corr. 1B |
| | Malonyl chloride Usage And Synthesis |
| Chemical Properties | clear yellow to orange to brown liquid | | Uses | Malonyl Dichloride is primarily used an intermediate in the manufacture of pharmaceutical and agrochemical products. | | Uses | Malonyl chloride can be used as a reactant for the synthesis of:
- Alkaloids with tetracyclic cores such as cyclopiamide A and speradine E.
- 6-tetrathiafulvalene(TTF)-polymer by condensation polymerization with TTF-based dihydroxy monomer.
- N-doped TiO2 films by molecular layer deposition.
- Alkyne-substituted 1,3-oxazines by reaction with arylpropynamides.
It can also be used as a coupling agent in the synthesis of block copolymers by anionic polymerization. | | Preparation | Malonyl chloride can be prepared from Malonic Acid and Thionyl Chloride. | | Reactions | reacts violently with H2O and protic solvents | | storage | Malonyl chloride is unstable at rt and should be used freshly distilled in vacuo or freshly prepared; however, it can be stored in the cold for several days; lachrymatory; use in a fume hood. |
| | Malonyl chloride Preparation Products And Raw materials |
|