2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone manufacturers
|
| | 2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone Basic information |
| Product Name: | 2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone | | Synonyms: | 4-(3,4-Dimethoxybenzylidene)-3-(3,4-dimethoxyphenyl)-1,5-bis(2-hydroxy-4,6-dimethoxyphenyl)pent-2-ene-1,5-dione;2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-4,6-dimethoxyphenyl)- | | CAS: | 10496-67-0 | | MF: | C19H20O6 | | MW: | 344.36 | | EINECS: | | | Product Categories: | Chalcones | | Mol File: | 10496-67-0.mol |  |
| | 2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone Chemical Properties |
| Melting point | 154 °C | | Boiling point | 558.5±50.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | pka | 6.73±0.40(Predicted) | | InChI | InChI=1S/C19H20O6/c1-22-13-10-15(21)19(18(11-13)25-4)14(20)7-5-12-6-8-16(23-2)17(9-12)24-3/h5-11,21H,1-4H3 | | InChIKey | CEBBHGDAHZDJTP-UHFFFAOYSA-N | | SMILES | C(C1=C(OC)C=C(OC)C=C1O)(=O)C=CC1=CC=C(OC)C(OC)=C1 |
| | 2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone Usage And Synthesis |
| | 2''-Hydroxy-3,4,4'',6''-tetramethoxychalcone Preparation Products And Raw materials |
|