|
|
| | 5-(Chloromethyl)-3-methyl-1,2,4-oxadiazole Basic information | | Application |
| Product Name: | 5-(Chloromethyl)-3-methyl-1,2,4-oxadiazole | | Synonyms: | 1,2,4-oxadiazole, 5-(chloromethyl)-3-methyl-;5-(chloromethyl)-3-methyl-1,2,4-oxadiazole(SALTDATA: FREE);-3-methyl-1,2,4-oxadiazole;5-(Chloromethyl)-3-methyl-1,2,4-oxadiazo | | CAS: | 1192-81-0 | | MF: | C4H5ClN2O | | MW: | 132.55 | | EINECS: | | | Product Categories: | | | Mol File: | 1192-81-0.mol |  |
| | 5-(Chloromethyl)-3-methyl-1,2,4-oxadiazole Chemical Properties |
| Boiling point | 112 °C(Press: 90 Torr) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | -1.10±0.32(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C4H5ClN2O/c1-3-6-4(2-5)8-7-3/h2H2,1H3 | | InChIKey | FYDQQEVRVKAASZ-UHFFFAOYSA-N | | SMILES | O1C(CCl)=NC(C)=N1 |
| HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 5-(Chloromethyl)-3-methyl-1,2,4-oxadiazole Usage And Synthesis |
| Application | 3-Methyl-5-(chloromethyl)-1,2,4-oxadiazole can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | 5-(Chloromethyl)-3-methyl-1,2,4-oxadiazole Preparation Products And Raw materials |
|