|
|
| | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol Basic information |
| Product Name: | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol | | Synonyms: | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol;Perfluorononanoic acid 13C5 (1,2,3,4,5-13C5);Nonanoic-1,2,3,4,5-13C5 acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-;Perfluorononanoic acid 13C5 (1,2,3,4,5-13C5) 50 μg/mL in Methanol:Water;PFNA-13C5;Perfluoro-n-[1,2,3,4,5-13C5]nonanoic acid | | CAS: | 960315-49-5 | | MF: | C9HF17O2 | | MW: | 469.04 | | EINECS: | | | Product Categories: | | | Mol File: | 960315-49-5.mol |  |
| | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol Chemical Properties |
| density | 1.753±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28)/i1+1,2+1,3+1,4+1,5+1 | | InChIKey | UZUFPBIDKMEQEQ-CVMUNTFWSA-N | | SMILES | [13C](F)(F)([13C](F)(F)[13C](F)(F)[13C](F)(F)[13C](=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol Usage And Synthesis |
| | Perfluoro-n-(1,2,3,4,5-13C5)nonanoic acid in Methanol Preparation Products And Raw materials |
|