|
|
| | 2-Chloro-6-iodobenzonitrile Basic information |
| | 2-Chloro-6-iodobenzonitrile Chemical Properties |
| Boiling point | 320.9±27.0 °C(Predicted) | | density | 2.01±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Light yellow to light brown Solid | | InChI | InChI=1S/C7H3ClIN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H | | InChIKey | MSYWVDNGKVMKIS-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(I)C=CC=C1Cl |
| Hazard Codes | Xn | | HS Code | 2926907090 |
| | 2-Chloro-6-iodobenzonitrile Usage And Synthesis |
| Uses | 2-Chloro-6-iodobenzonitrile (cas# 89642-53-5) is a compound useful in organic synthesis. |
| | 2-Chloro-6-iodobenzonitrile Preparation Products And Raw materials |
|