|
|
| | 3,5-Diacetoxyacetophenone Basic information |
| | 3,5-Diacetoxyacetophenone Chemical Properties |
| Melting point | 91-94 °C(lit.) | | Boiling point | 165-168 °C (0.7501 mmHg) | | density | 1.3026 (rough estimate) | | refractive index | 1.5140 (estimate) | | Fp | 168.7oC | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Dichloromethane, Methanol | | form | powder to crystal | | color | White to Brown | | Stability: | Stable under normal temperatures and pressures. | | InChI | InChI=1S/C12H12O5/c1-7(13)10-4-11(16-8(2)14)6-12(5-10)17-9(3)15/h4-6H,1-3H3 | | InChIKey | QODJHYBESCIPOG-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(OC(C)=O)=CC(OC(C)=O)=C1)C | | LogP | 1.5 at 25.5℃ | | CAS DataBase Reference | 35086-59-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 9-21 | | Hazard Note | Irritant | | HS Code | 29145090 |
| | 3,5-Diacetoxyacetophenone Usage And Synthesis |
| Description | 3,5-Diacetoxyacetophenone is an important intermediate compound with a wide range of applications in chemical synthesis and pharmaceutical research. It can be used in the synthesis of Fenoterol and Orciprenaline. Fenoterol is a β-adrenergic receptor agonist used in the treatment of reversible airway obstruction seen in asthma and chronic obstructive pulmonary disease. | | Chemical Properties | Yellow to brown powder | | Uses | 3’,5’-Diacetyloxyacetophenone (cas# 35086-59-0) is a compound useful in organic synthesis. |
| | 3,5-Diacetoxyacetophenone Preparation Products And Raw materials |
|