1-PIPERIDINEPROPIONIC ACID manufacturers
|
| | 1-PIPERIDINEPROPIONIC ACID Basic information |
| | 1-PIPERIDINEPROPIONIC ACID Chemical Properties |
| Melting point | 105-110 °C (lit.) | | Boiling point | 105-108 °C/0.5 mmHg (lit.) | | density | 1.0806 (rough estimate) | | refractive index | 1.4590 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.83±0.10(Predicted) | | form | Powder | | color | White to pale brown | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | InChI=1S/C8H15NO2/c10-8(11)4-7-9-5-2-1-3-6-9/h1-7H2,(H,10,11) | | InChIKey | LPDGWMLCUHULJF-UHFFFAOYSA-N | | SMILES | N1(CCC(O)=O)CCCCC1 | | EPA Substance Registry System | 1-Piperidinepropanoic acid (26371-07-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-PIPERIDINEPROPIONIC ACID Usage And Synthesis |
| Uses | Reactant for synthesis of:
Protease activated receptor 2 agonists
Selective 5-HT6 antagonists
Kinesin Eg5 inhibitors
Selective ketone histone deacetylase inhibitors
JNK2 and JNK3 inhibitors
Opioid receptor antagonists | | General Description | 1-Piperidinepropionic acid is an amino acid and its effectiveness as plasticizer has been tested. |
| | 1-PIPERIDINEPROPIONIC ACID Preparation Products And Raw materials |
|