- 2,4-Dibromopyridine
-
- $47.00 / 25g
-
2026-05-15
- CAS:58530-53-3
- Min. Order: 25g
- Purity: 0.98
- Supply Ability: 25kg
- 2,4-Dibromopyridine
-
- $0.00 / 25KG
-
2025-12-01
- CAS:58530-53-3
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
- 2,4-Dibromopyridine
-
- $1.10 / 1g
-
2025-11-18
- CAS:58530-53-3
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons min
|
| | 2,4-Dibromopyridine Basic information |
| Product Name: | 2,4-Dibromopyridine | | Synonyms: | 2,4-DIBROMO-6-NITROPHENOL;Pyridine, 2,4-dibromo-;2,4-DIBROMOPYRIDINE;2,4-Dibromopyridine FP170207;2,4-Dibromopyridine >;2,4-Dibromopyridine ISO 9001：2015 REACH;(2-Bromo-5-methoxy-31-methyl-phenyl)-methano;2,4-Dibromopyridine, 97% | | CAS: | 58530-53-3 | | MF: | C5H3Br2N | | MW: | 236.89 | | EINECS: | 663-373-4 | | Product Categories: | Organohalides;Halides;pharmacetical;Heterocyclic Series;blocks;Bromides;Pyridines;Pyridine | | Mol File: | 58530-53-3.mol |  |
| | 2,4-Dibromopyridine Chemical Properties |
| Melting point | 35-40 °C | | Boiling point | 238°C(lit.) | | density | 2.059±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to lump to clear liquid | | pka | 0.17±0.10(Predicted) | | color | White or Colorless to Almost white or Almost colorless | | Sensitive | Hygroscopic | | InChI | InChI=1S/C5H3Br2N/c6-4-1-2-8-5(7)3-4/h1-3H | | InChIKey | PCMMSLVJMKQWMQ-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=CC(Br)=C1 | | CAS DataBase Reference | 58530-53-3(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38-22 | | Safety Statements | 26-36/37/39-36-37-22 | | RIDADR | 2811 | | WGK Germany | 1 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2,4-Dibromopyridine Usage And Synthesis |
| Chemical Properties | Light yellow needles | | Uses | 2,4-Dibromopyridine is a useful research chemical used in the synthesis of novel pyridine-bridged analogs of combretastatin-A4 as anticancer agents. |
| | 2,4-Dibromopyridine Preparation Products And Raw materials |
|