|
|
| | TETRAFLUORO-1,4-BENZOQUINONE Basic information |
| Product Name: | TETRAFLUORO-1,4-BENZOQUINONE | | Synonyms: | 2,3,5,6-Tetrafluorocyclohexa-2,5-diene-1,4-dione, p-Fluoranil;2,3,5,6-tetrafluorocyclohexa-2,5-diene-1,4-dione;NSC 264881;Tetrafluoro-p-quinone;FLUOROANIL;FLUORANIL;TETRAFLUORO-P-BENZOQUINONE;P-FLUORANIL | | CAS: | 527-21-9 | | MF: | C6F4O2 | | MW: | 180.06 | | EINECS: | 208-411-9 | | Product Categories: | Benzoquinones;C3 to C6;Carbonyl Compounds;Ketones;Anthraquinones, Hydroquinones and Quinones | | Mol File: | 527-21-9.mol |  |
| | TETRAFLUORO-1,4-BENZOQUINONE Chemical Properties |
| Melting point | 183-186 °C (subl.) (lit.) | | Boiling point | 133.1±40.0 °C(Predicted) | | density | 1.6138 (estimate) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 1875039 | | Stability: | Stable. Non-flammable. Incompatible with strong oxidizing agents, alkali metals, strong reducing agents. | | InChI | 1S/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 | | InChIKey | JKLYZOGJWVAIQS-UHFFFAOYSA-N | | SMILES | FC1=C(F)C(=O)C(F)=C(F)C1=O | | CAS DataBase Reference | 527-21-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TETRAFLUORO-1,4-BENZOQUINONE Usage And Synthesis |
| Chemical Properties | slightly brown powder with a pungent odour | | Uses | Tetrafluoro-1,4-benzoquinone (fluoranil) can be used to prepare:
- Symmetrical or unsymmetrical ethers by coupling of two alcohols via the oxidation-reduction condensation reaction.
- Azocino[4,3-b]indole scaffold, which is used as an inetermediate to prepare (±)-dasycarpidone.
- Chiral and racemic charge-transfer (CT) complexes with binaphthol.
|
| | TETRAFLUORO-1,4-BENZOQUINONE Preparation Products And Raw materials |
|