- Neopentanediol dimethacrylate
-
- $100.00 / 1KG
-
2025-09-25
- CAS:1985-51-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Neopentyl glycol dimethacrylate Basic information |
| Product Name: | Neopentyl glycol dimethacrylate | | Synonyms: | DIMETHYLTRIMETHYLENE GLYCOL DIMETHACRYLATE;2,2-DIMETHYLPROPANEDIOL DIMETHACRYLATE;2,2-DIMETHYL-1,3-PROPANEDIOL DIMETHACRYLATE;1,3-BIS(METHACRYLOYLOXY)-2,2-DIMETHYLPROPANE;NEOPENTYL GLYCOL DIMETHACRYLATE;2,2-Dimethylpropanedimethacrylate;2,2-Dimethylpropane-1,3-diyl bis(2-methylacrylate);2,2-dimethylpropane-1,1-diol | | CAS: | 1985-51-9 | | MF: | C13H20O4 | | MW: | 240.3 | | EINECS: | 217-856-8 | | Product Categories: | | | Mol File: | 1985-51-9.mol |  |
| | Neopentyl glycol dimethacrylate Chemical Properties |
| Melting point | 5°C | | Boiling point | 87 °C0.6 mm Hg(lit.) | | density | 1.003 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.453(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | Cosmetics Ingredients Functions | NAIL CONDITIONING | | InChI | InChI=1S/C13H20O4/c1-9(2)11(14)16-7-13(5,6)8-17-12(15)10(3)4/h1,3,7-8H2,2,4-6H3 | | InChIKey | ULQMPOIOSDXIGC-UHFFFAOYSA-N | | SMILES | C(OC(=O)C(C)=C)C(C)(C)COC(=O)C(C)=C | | LogP | 2.790 | | CAS DataBase Reference | 1985-51-9(CAS DataBase Reference) | | EPA Substance Registry System | Neopentyl glycol dimethacrylate (1985-51-9) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | RIDADR | 2810 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2917.19.7050 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Neopentyl glycol dimethacrylate Usage And Synthesis |
| Description |
Neopentyl glycol dimethacrylate is a kind of functional methyl acrylic ester, can be used as peroxyde crosslinked additional crosslinker, is applicable to the elastomeric vulcanization system of sulfur vulcanization difficulty. There is a shortening crosslinking time, improving features such as vulcanized rubber. Also, it can be used as a properties-correcting agent, applicable to the radiation crosslinking of PVC electric wire and photosensitive resin, tackiness agent, coating, porous plastics, etc.
|
| | Neopentyl glycol dimethacrylate Preparation Products And Raw materials |
|