|
|
| | 3-(4-METHOXYBENZOYL)PROPIONIC ACID Basic information |
| | 3-(4-METHOXYBENZOYL)PROPIONIC ACID Chemical Properties |
| Melting point | 148-150 °C(lit.) | | Boiling point | 307.4°C (rough estimate) | | density | 1.2252 (rough estimate) | | refractive index | 1.5020 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 4.58±0.17(Predicted) | | color | White to Orange to Green | | Water Solubility | 18g/L at 25℃ | | BRN | 785074 | | InChI | InChI=1S/C11H12O4/c1-15-9-4-2-8(3-5-9)10(12)6-7-11(13)14/h2-5H,6-7H2,1H3,(H,13,14) | | InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N | | SMILES | C1(C=CC(OC)=CC=1)C(=O)CCC(=O)O | | LogP | 1.38 | | CAS DataBase Reference | 3153-44-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-(4-METHOXYBENZOYL)PROPIONIC ACID Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER | | Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 331, 1948 DOI: 10.1021/ja01181a103 |
| | 3-(4-METHOXYBENZOYL)PROPIONIC ACID Preparation Products And Raw materials |
|