- Dihydromyrcene
-
- $25.00 / 1ASSAYS
-
2026-03-20
- CAS:2436-90-0
- Min. Order: 100ASSAYS
- Purity: 99.5%
- Supply Ability: 100 mt
- Dihydromyrcene
-
- $0.00 / 25kg
-
2025-12-01
- CAS:2436-90-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- Dihydromyrcene
-
- $10.50 / 1KG
-
2025-05-26
- CAS:2436-90-0
- Min. Order: 1KG
- Purity: 85%
- Supply Ability: 10 ton
|
| | Dihydromyrcene Basic information |
| Product Name: | Dihydromyrcene | | Synonyms: | 3,7-DIMETHYL-1,6-OCTADIENE;2,6-Dimethyl-2,7-octadiene;(+)-BETA-CITRONELLENE;DIHYDROMYRCENE;1.4350-1.4420;166-168℃;(+)-β-citronellene;1,6-Octadiene, 3,7-dimethyl- | | CAS: | 2436-90-0 | | MF: | C10H18 | | MW: | 138.25 | | EINECS: | 219-433-3 | | Product Categories: | | | Mol File: | 2436-90-0.mol |  |
| | Dihydromyrcene Chemical Properties |
| Melting point | -69.6°C (estimate) | | Boiling point | 154-155 °C(lit.) | | density | 0.760 g/mL at 20 °C(lit.) | | vapor pressure | 4.09hPa at 20℃ | | refractive index | n20/D 1.437 | | Fp | 38 °C | | storage temp. | 2-8°C | | Appearance | Colorless to light yellow Liquid | | Odor | at 100.00 %. citronellol herbal citrus terpenic | | Odor Type | floral | | Water Solubility | 2.24mg/L at 20℃ | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,7,10H,1,6,8H2,2-4H3 | | InChIKey | FUDNBFMOXDUIIE-UHFFFAOYSA-N | | SMILES | C=CC(C)CC/C=C(\C)/C | | LogP | 5.796 at 25℃ | | CAS DataBase Reference | 2436-90-0(CAS DataBase Reference) | | NIST Chemistry Reference | 2,6-Dimethyl 2,7-octadiene(2436-90-0) | | EPA Substance Registry System | Dihydromyrcene (2436-90-0) |
| RIDADR | UN 2319 3/PG 3 | | WGK Germany | 2 | | RTECS | RG5340000 | | F | 10 | | TSCA | TSCA listed |
| | Dihydromyrcene Usage And Synthesis |
| Chemical Properties | Colorless and transparent liquid | | Uses | Dihydromyrcene is used as a fragrance intermediate and can be used to synthesize dihydromyrcenol. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 51, p. 2126, 1986 DOI: 10.1021/jo00361a038 | | Safety Profile | A skin irritant. When
heated to decomposition it emits acrid
smoke and irritating fumes. |
| | Dihydromyrcene Preparation Products And Raw materials |
|