|
|
| | ALBENDAZOLE SULFONE Basic information |
| | ALBENDAZOLE SULFONE Chemical Properties |
| Melting point | 290-292°C | | density | 1.420±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Soluble in DMSO, and methanol. | | form | solid | | pka | 10.11±0.10(Predicted) | | color | White to Brown | | BRN | 8394880 | | InChI | InChI=1S/C12H15N3O4S/c1-3-6-20(17,18)8-4-5-9-10(7-8)14-11(13-9)15-12(16)19-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) | | InChIKey | CLSJYOLYMZNKJB-UHFFFAOYSA-N | | SMILES | C(OC)(=O)NC1NC2=CC(S(CCC)(=O)=O)=CC=C2N=1 | | CAS DataBase Reference | 75184-71-3 |
| Hazard Codes | Xn | | Risk Statements | 63-36/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | RTECS | DD6520700 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Repr. 2
STOT RE 2 Oral |
| | ALBENDAZOLE SULFONE Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | A metabolite of Albendazole, an anthelmintic | | Uses | Albendazole are currently used for chemotherapeutic treatment of AE. Albendazole sulfone is used as scolicidal agents on hydatid cysts(in vitro). | | Definition | ChEBI: Albendazole sulfone is an organic sulfide. | | Hazard | A reproductive hazard. |
| | ALBENDAZOLE SULFONE Preparation Products And Raw materials |
|