|
|
| | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid Basic information |
| Product Name: | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid | | Synonyms: | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid;5-Isoxazolecarboxylic acid, 3-(4-methylphenyl)-;3-p-tolylisoxazole-5-carboxylic acid;3-p-Tolylisoxazole-5-carboxylic acid;3-(4-Methylphenyl)-5-isoxazolecarboxylic acid | | CAS: | 134378-95-3 | | MF: | C11H9NO3 | | MW: | 203.19 | | EINECS: | | | Product Categories: | | | Mol File: | 134378-95-3.mol |  |
| | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid Chemical Properties |
| storage temp. | Store at room temperature | | form | solid | | Appearance | Off-white to yellow Solid | | InChI | 1S/C11H9NO3/c1-7-2-4-8(5-3-7)9-6-10(11(13)14)15-12-9/h2-6H,1H3,(H,13,14) | | InChIKey | QHISGBCCUGZEEN-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(C(C=C2)=CC=C2C)=NO1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid Usage And Synthesis |
| | 3-(4-methylphenyl)-1,2-oxazole-5-carboxylic acid Preparation Products And Raw materials |
|