| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 2-(1-Carboxy-3-methyl-butyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Basic information |
| | 2-(1-Carboxy-3-methyl-butyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Chemical Properties |
| form | solid | | InChI | 1S/C15H15NO6/c1-7(2)5-11(15(21)22)16-12(17)9-4-3-8(14(19)20)6-10(9)13(16)18/h3-4,6-7,11H,5H2,1-2H3,(H,19,20)(H,21,22) | | InChIKey | MLBQKULJXDHKHT-UHFFFAOYSA-N | | SMILES | N1(C(=O)c2c(ccc(c2)C(=O)O)C1=O)C(CC(C)C)C(=O)O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2-(1-Carboxy-3-methyl-butyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Usage And Synthesis |
| | 2-(1-Carboxy-3-methyl-butyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid Preparation Products And Raw materials |
|