Diethyl(methylsulfonylmethyl)phosphonate manufacturers
|
| | Diethyl(methylsulfonylmethyl)phosphonate Basic information |
| Product Name: | Diethyl(methylsulfonylmethyl)phosphonate | | Synonyms: | Diethyl(methylsulfonylmethyl)phosphonate;Phosphonic acid, P-[(methylsulfonyl)methyl]-, diethyl ester;Phosphonic acid, [(methylsulfonyl)methyl]-, diethyl ester;1-[ethoxy(methylsulfonylmethyl)phosphoryl]oxyethane;Diethyl?P-[(methylsulfonyl)methyl]phosphonate | | CAS: | 40137-11-9 | | MF: | C6H15O5PS | | MW: | 230.22 | | EINECS: | | | Product Categories: | | | Mol File: | 40137-11-9.mol |  |
| | Diethyl(methylsulfonylmethyl)phosphonate Chemical Properties |
| Melting point | 93-95°C | | Boiling point | 373.6±25.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | sol acetone, CH2Cl2, DME, THF. | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H15O5PS/c1-4-10-12(7,11-5-2)6-13(3,8)9/h4-6H2,1-3H3 | | InChIKey | DFCKGLGTOXDULU-UHFFFAOYSA-N | | SMILES | P(CS(C)(=O)=O)(=O)(OCC)OCC |
| | Diethyl(methylsulfonylmethyl)phosphonate Usage And Synthesis |
| Uses | Diethyl Methylsulfonylmethylphosphonate is used for the preparation of synthetically versatile vinyl sulfones from aldehydes and ketones. | | Preparation | Preparative Methods: conveniently prepared by oxidation of Diethyl Methylthiomethylphosphonate (eq 1).
Both inorganic oxidants (e.g. Potassium Permanganate in water or Hydrogen Peroxide/Selenium(IV)
Oxide) and organic oxidants (e.g. Peracetic Acid in ether or m-Chloroperbenzoic Acid in CH2Cl2
) have
been used to accomplish this transformation.
 | | storage | Diethyl methylsulfonylmethylphosphonate is reasonably stable for
storage. Reactions involving this reagent are best conducted under anhydrous conditions, under nitrogen, in a
well ventilated fume hood. |
| | Diethyl(methylsulfonylmethyl)phosphonate Preparation Products And Raw materials |
|