- Bisoprolol EP Imp L
-
- $1.00 / 1KG
-
2020-02-01
- CAS:29122-74-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | H 128/80 Basic information |
| | H 128/80 Chemical Properties |
| Melting point | >90°C (dec.) | | Boiling point | 402.5±35.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.76±0.20(Predicted) | | color | Pale Orange to Brown | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C13H19NO3/c1-10(2)14-7-12(16)9-17-13-5-3-11(8-15)4-6-13/h3-6,8,10,12,14,16H,7,9H2,1-2H3 | | InChIKey | BGHLBXLHZRCXRY-UHFFFAOYSA-N | | SMILES | Cl.CC(C)NCC(O)COc1ccc(C=O)cc1 |
| WGK Germany | WGK 3 | | HS Code | 2922504500 | | Storage Class | 11 - Combustible Solids |
| | H 128/80 Usage And Synthesis |
| Uses | A Metoprolol impurity . | | Uses | A Labelled metoprolol impurity . | | Uses | Alkanolamine derivative as -adrenoceptor antagonist |
| | H 128/80 Preparation Products And Raw materials |
|