|
|
| | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate Basic information |
| Product Name: | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate | | Synonyms: | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate;1,4-Dimethyl-1H-pyrazol-3-carboxylic acid ethyl ester;Ethyl 1,4-diMethylpyrazole-3-carboxylate;1H-Pyrazole-3-carboxylic acid, 1,4-diMethyl-, ethyl ester;1H-Pyrazole-3-carboxylic acid, 1,4-dimethyl-, ethyl ester (9CI, ACI);1,4-dimethyl-1H-Pyrazole-3-carboxylic acid ethyl ester (9CI ACI) | | CAS: | 68809-65-4 | | MF: | C8H12N2O2 | | MW: | 168.19 | | EINECS: | | | Product Categories: | | | Mol File: | 68809-65-4.mol |  |
| | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate Chemical Properties |
| Boiling point | 248℃ | | density | 1.12 | | Fp | 104℃ | | storage temp. | 2-8°C | | InChI | InChI=1S/C8H12N2O2/c1-4-12-8(11)7-6(2)5-10(3)9-7/h5H,4H2,1-3H3 | | InChIKey | HIQXUZYXOVSBRY-UHFFFAOYSA-N | | SMILES | N1(C)C=C(C)C(C(OCC)=O)=N1 |
| | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate Usage And Synthesis |
| | ethyl 1,4-dimethyl-1H-pyrazole-3-carboxylate Preparation Products And Raw materials |
|