DESOXYANISOIN manufacturers
- DESOXYANISOIN
-
- $3.00 / 1KG
-
2020-02-02
- CAS:120-44-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
- DESOXYANISOIN
-
- $0.00 / 1g
-
2019-11-08
- CAS:120-44-5
- Min. Order: 1g
- Purity: 99.5%min
- Supply Ability: 20kg/week
|
| | DESOXYANISOIN Basic information |
| Product Name: | DESOXYANISOIN | | Synonyms: | 1,2-Bis(p-methoxyphenyl)ethanone;1,2-Di-p-anisylethanone;4,4'-Dimethoxydeoxybenzoin;Acetophenone, 4'-methoxy-2-(p-methoxyphenyl)-;Deoxy-4-anisoin;Deoxy-p-anisoin;Ethanone, 1,2-bis(4-methoxyphenyl)-;Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone | | CAS: | 120-44-5 | | MF: | C16H16O3 | | MW: | 256.3 | | EINECS: | 204-396-8 | | Product Categories: | Aromatic Ketones (substituted) | | Mol File: | 120-44-5.mol |  |
| | DESOXYANISOIN Chemical Properties |
| Melting point | 110-112 °C (lit.) | | Boiling point | 339.54°C (rough estimate) | | density | 1.115 | | refractive index | 1.4500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Sparingly soluble in water. | | BRN | 1536594 | | InChI | InChI=1S/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 | | InChIKey | SICBLYCPRWNHHP-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(OC)C=C1)CC1=CC=C(OC)C=C1 | | CAS DataBase Reference | 120-44-5(CAS DataBase Reference) | | EPA Substance Registry System | Desoxyanisoin (120-44-5) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | DESOXYANISOIN Usage And Synthesis |
| Chemical Properties | WHITE TO SLIGHTLY YELLOW CRYSTALS OR CRYST. POWDER | | Uses | Deoxyanisoin react to produce a-bromo-4,4'-dimethoxy-deoxybenzoin, and this reaction could happen in the reagent of CCl4 and bromine. |
| | DESOXYANISOIN Preparation Products And Raw materials |
|