|
|
| | methyl 5-tert-butyl-2-hydroxybenzoate Basic information |
| | methyl 5-tert-butyl-2-hydroxybenzoate Chemical Properties |
| Boiling point | 90-100 °C | | density | 1.082±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 9.97±0.18(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C12H16O3/c1-12(2,3)8-5-6-10(13)9(7-8)11(14)15-4/h5-7,13H,1-4H3 | | InChIKey | DDERNNBGPTTXMY-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(C(C)(C)C)=CC=C1O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | methyl 5-tert-butyl-2-hydroxybenzoate Usage And Synthesis |
| | methyl 5-tert-butyl-2-hydroxybenzoate Preparation Products And Raw materials |
|