|
|
| | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE Basic information |
| Product Name: | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE | | Synonyms: | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE;cis-4-Cyclohexene-1,2-dicarboxylic Acid Dimethyl Ester;Dimethyl cis-4-Cyclohexene-1,2-dicarboxylate;Dimethyl (1r,2s)-cyclohex-4-ene-1,2-dicarboxylate;cis-Dimethyl cyclohex-4-ene-1,2-dicarboxylate;Dimethylcis-4-Cyclohexene-1,2-dicarboxylate>;4-Cyclohexene-1,2-dicarboxylic acid, dimethyl ester, (1R,2S)-rel-;rel-Dimethyl (1R,2S)-cyclohex-4-ene-1,2-dicarboxylate | | CAS: | 4841-84-3 | | MF: | C10H14O4 | | MW: | 198.22 | | EINECS: | | | Product Categories: | C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 4841-84-3.mol |  |
| | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE Chemical Properties |
| Boiling point | 141-142 °C20 mm Hg(lit.) | | density | 1.145 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.472(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | 1S/C10H14O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ | | InChIKey | DVVAGRMJGUQHLI-OCAPTIKFSA-N | | SMILES | COC(=O)[C@H]1CC=CC[C@H]1C(=O)OC |
| WGK Germany | 3 | | HS Code | 2917399590 | | Storage Class | 10 - Combustible liquids |
| | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE Usage And Synthesis |
| Uses | Dimethyl cis-1,2,3,6-tetrahydrophthalate may be used in chemical synthesis. | | General Description | Epoxidation of dimethyl cis-1,2,3,6-tetrahydrophthalate has been reported. Desymmetrization of dimethyl cis-1,2,3,6-tetrahydrophthalate to (1S,2R)-1-methyl-cis-1,2,3,6-tetra-hydrophthalate has been reported. |
| | DIMETHYL CIS-1,2,3,6-TETRAHYDROPHTHALATE Preparation Products And Raw materials |
|