- BOC-GLN-ONP
-
- $7.00 / 1KG
-
2019-09-02
- CAS: 15387-45-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 351
|
| | BOC-GLN-ONP Basic information |
| | BOC-GLN-ONP Chemical Properties |
| Melting point | 146 - 148°C | | Boiling point | 617.5±55.0 °C(Predicted) | | density | 1.291±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) | | pka | 10.70±0.46(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 1896303 | | Major Application | peptide synthesis | | InChI | 1S/C16H21N3O7/c1-16(2,3)26-15(22)18-12(8-9-13(17)20)14(21)25-11-6-4-10(5-7-11)19(23)24/h4-7,12H,8-9H2,1-3H3,(H2,17,20)(H,18,22)/t12-/m0/s1 | | InChIKey | HJMMCTZLXOVMFB-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(N)=O)C(=O)Oc1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 15387-45-8(CAS DataBase Reference) | | EPA Substance Registry System | L-Glutamine, N2-[(1,1-dimethylethoxy)carbonyl]-, 4-nitrophenyl ester (15387-45-8) |
| WGK Germany | 3 | | F | 8 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | BOC-GLN-ONP Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Substrate for cathepsin B. | | Uses | Boc-Gln-ONp is an amino acid building block used in chemical synthesis and peptide chemistry. |
| | BOC-GLN-ONP Preparation Products And Raw materials |
|