|
|
| | 3-Methyl-2-nitroanisole Basic information |
| | 3-Methyl-2-nitroanisole Chemical Properties |
| Melting point | 48-50 °C (lit.) | | Boiling point | 170 °C / 35mmHg | | density | 1.2917 (rough estimate) | | refractive index | 1.5570 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | BRN | 2329690 | | InChI | 1S/C8H9NO3/c1-6-4-3-5-7(12-2)8(6)9(10)11/h3-5H,1-2H3 | | InChIKey | MGBRGNWARSQECY-UHFFFAOYSA-N | | SMILES | COc1cccc(C)c1[N+]([O-])=O | | CAS DataBase Reference | 5345-42-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-36-26-25-24 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HS Code | 29093090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Methyl-2-nitroanisole Usage And Synthesis |
| Chemical Properties | white to yellowish crystals |
| | 3-Methyl-2-nitroanisole Preparation Products And Raw materials |
|