|
|
| | 4-Fluorobenzenesulfonamide Basic information |
| | 4-Fluorobenzenesulfonamide Chemical Properties |
| Melting point | 124-127 °C (lit.) | | Boiling point | 307.9±44.0 °C(Predicted) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 10.00±0.10(Predicted) | | color | White to Almost white | | Water Solubility | It is soluble in water. | | InChI | InChI=1S/C6H6FNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) | | InChIKey | LFLSATHZMYYIAQ-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(F)C=C1 | | CAS DataBase Reference | 402-46-0(CAS DataBase Reference) |
| Hazard Codes | T,Xi | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | DB2630000 | | Hazard Note | Irritant/Toxic | | HazardClass | IRRITANT | | HS Code | 29350090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Fluorobenzenesulfonamide Usage And Synthesis |
| Uses | 4-Fluorobenzenesulfonamide, is used to produce bis-(4-fluoro-benzenesulfonyl)-amine with 4-fluoro-benzenesulfonyl chloride at temperature of 55 - 60. This reaction will need reagent OH-. | | Uses | 4-Fluorobenzenesulfonamide may be used to synthesize 4-fluorophenylsulfonyldithiocarbimate potassium dihydrate and amino-substituted sulfanilamide derivatives. | | General Description | 4-Fluorobenzenesulfonamide is a para-halogen benzenesulfonamide. Ab initio Hartree-Fock (HF) and density functional theory (DFT) have been used to investigate the structural features of 4-fluorobenzenesulfonamide. |
| | 4-Fluorobenzenesulfonamide Preparation Products And Raw materials |
|