|
|
| | 3,4-Epoxytetrahydrofuran Basic information | | Uses |
| Product Name: | 3,4-Epoxytetrahydrofuran | | Synonyms: | 3,4-EPOXYTETRAHYDROFURAN;3,6-DIOXABICYCLO[3.1.0]HEXANE;3,4-EPOXYTETRAHYDROFURAN 96%;3,4-Epoxytetrahydrofurane;3,4-Epoxytetrahydrofuran, 98 %;3,4-Epoxy-THF;3,4-Diepoxytetrahydrofuran;3,4-Epoxytetrahydrofuran,96% | | CAS: | 285-69-8 | | MF: | C4H6O2 | | MW: | 86.09 | | EINECS: | 206-006-1 | | Product Categories: | | | Mol File: | 285-69-8.mol |  |
| | 3,4-Epoxytetrahydrofuran Chemical Properties |
| Boiling point | 44°C 10mm | | density | 1.237 | | refractive index | 1.445-1.449 | | Fp | >38℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | color | Clear yellow | | Water Solubility | MODERATELY SOLUBLE | | InChI | InChI=1S/C4H6O2/c1-3-4(6-3)2-5-1/h3-4H,1-2H2 | | InChIKey | AIUTZIYTEUMXGG-UHFFFAOYSA-N | | SMILES | C12C(O1)COC2 | | CAS DataBase Reference | 285-69-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-10 | | Safety Statements | 36/37/39-26-23-16-36/37/38 | | RIDADR | 1993 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,4-Epoxytetrahydrofuran Usage And Synthesis |
| Uses | 3,6-Dioxabicyclo[3.1.0]hexane was a reagent used in making various degradable polymers from epoxides using a versatile dinuclear chromium catalyst. | | Chemical Properties | clear yellow liquid | | Synthesis | Step 1: 85% m-chloroperoxybenzoic acid (mCPBA) (18.86 g, 0.093 mol) was slowly added to 150 mL of dichloromethane solution containing 2,5-dihydrofuran (5.04 g, 0.072 mol) at 0°C in an ice-water bath. The reaction mixture was stirred at room temperature for 48 hours. After completion of the reaction, the precipitate was removed by filtration. The filtrate was washed sequentially with saturated aqueous sodium bicarbonate, water and brine. The organic layer was dried over anhydrous sodium sulfate and concentrated under reduced pressure to give a mixture of white solid and yellow oil (5.24 g, 84.6% yield). | | References | [1] Patent: WO2008/33562, 2008, A2. Location in patent: Page/Page column 53
[2] Patent: US2009/76005, 2009, A1. Location in patent: Page/Page column 23
[3] Bioorganic and Medicinal Chemistry, 2006, vol. 14, # 24, p. 8467 - 8487
[4] Patent: US5374416, 1994, A
[5] Patent: US2009/30212, 2009, A1. Location in patent: Page/Page column 15-16 |
| | 3,4-Epoxytetrahydrofuran Preparation Products And Raw materials |
|