|
|
| | Cyclohexanedimethanol divinyl ether Basic information |
| Product Name: | Cyclohexanedimethanol divinyl ether | | Synonyms: | 1,4-Bis-(hydroxymethyl)-cyclohexane-divinylether;1,4-CYCLOHEXANEDIMETHANOL DIVINYL ETHER;DIVINYLOXY 1,4-CYCLOHEXANEDIMETHANOL;CYCLOHEXANEDIMETHANOL DIVINYL ETHER;1,4-CYCLOHEXANEDIMETHANOL DIVINYL ETHER, 98%, MIXTURE OF ISOMERS;Cyclohexane-1,4-dimethanoldivinylether(mixtureofisomers)gc;CYCLOHEXANE-1,4-DIMETHANOLDIVINYLETHER (MIXTURE OF ISOMERS);Cyclohexane, 1,4-bis(ethenyloxy)methyl- | | CAS: | 17351-75-6 | | MF: | C12H20O2 | | MW: | 196.29 | | EINECS: | 413-370-7 | | Product Categories: | Vinyl Ethers;Biomaterials;Crosslinking Agents;Materials Science;Polymer Science;Crosslinking AgentsPolymer Science;Biocompatible/Biodegradable Materials;Materials Science;Monomers;Vinyl Ethers | | Mol File: | 17351-75-6.mol |  |
| | Cyclohexanedimethanol divinyl ether Chemical Properties |
| Melting point | 6°C | | Boiling point | 126 °C14 mm Hg(lit.) | | density | 0.919 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.472(lit.) | | Fp | >230 °F | | form | liquid | | InChI | InChI=1S/C12H20O2/c1-3-13-9-11-5-7-12(8-6-11)10-14-4-2/h3-4,11-12H,1-2,5-10H2 | | InChIKey | DQNSRQYYCSXZDF-UHFFFAOYSA-N | | SMILES | C1(COC=C)CCC(COC=C)CC1 | | EPA Substance Registry System | Cyclohexane, 1,4-bis[(ethenyloxy)methyl]- (17351-75-6) |
| Hazard Codes | Xi,N | | Risk Statements | 43-51/53-38 | | Safety Statements | 24-37-61 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | GV5170000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Chronic 2
Skin Irrit. 2
Skin Sens. 1 |
| | Cyclohexanedimethanol divinyl ether Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | Cyclohexanedimethanol divinyl ether Preparation Products And Raw materials |
|