|
|
| | 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,ethyl ester Basic information |
| | 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,ethyl ester Chemical Properties |
| Melting point | 45-48° | | Boiling point | 264.7±40.0 °C(Predicted) | | density | 1.284±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | -0.60±0.10(Predicted) | | color | Pale yellow | | InChI | 1S/C9H8F3NO2/c1-2-15-8(14)7-4-3-6(5-13-7)9(10,11)12/h3-5H,2H2,1H3 | | InChIKey | KCMOTZFSBYHKCI-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1ccc(cn1)C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,ethyl ester Usage And Synthesis |
| | 2-Pyridinecarboxylic acid,5-(trifluoromethyl)-,ethyl ester Preparation Products And Raw materials |
|