|
|
| | S-Phenylmercapturic acid Basic information |
| | S-Phenylmercapturic acid Chemical Properties |
| Melting point | 110-112°C | | Boiling point | 494.5±40.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 3.25±0.10(Predicted) | | color | Off-White to Pale Yellow | | Optical Rotation | [α]/D -25.0±2.0°, c = 1 in ethanol | | Stability: | Hygroscopic | | Major Application | clinical testing | | InChI | 1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 | | InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N | | SMILES | CC(=O)N[C@@H](CSc1ccccc1)C(O)=O | | EPA Substance Registry System | L-Cysteine, N-acetyl-S-phenyl- (4775-80-8) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S-Phenylmercapturic acid Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | An important metabolite of Benzene. |
| | S-Phenylmercapturic acid Preparation Products And Raw materials |
|