| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:S-PhenylMercapturic Acid CAS:4775-80-8 Package:100Mg,250Mg
|
| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
821-50328103-801 18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:S-PHENYLMERCAPTURIC ACID CAS:4775-80-8 Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
info@syntechem.com |
| Products Intro: |
Product Name:(R)-2-acetaMido-3-(phenylthio)propanoic acid CAS:4775-80-8 Purity:97% Package:1g;5g;25g;100g;250g;1kg;5kg;10kg;25kg Remarks:we offer low price custom synthesis and contract manufacturing
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:S-PhenylMercapturic Acid CAS:4775-80-8 Remarks:CS-T-15137
|
|
| | S-PHENYLMERCAPTURIC ACID Basic information |
| | S-PHENYLMERCAPTURIC ACID Chemical Properties |
| Melting point | 110-112°C | | Boiling point | 494.5±40.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Slightly) | | pka | 3.25±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Yellow | | Optical Rotation | [α]/D -25.0±2.0°, c = 1 in ethanol | | Stability: | Hygroscopic | | Major Application | clinical testing | | InChI | 1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 | | InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N | | SMILES | CC(=O)N[C@@H](CSc1ccccc1)C(O)=O | | EPA Substance Registry System | L-Cysteine, N-acetyl-S-phenyl- (4775-80-8) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | S-PHENYLMERCAPTURIC ACID Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | An important metabolite of Benzene. |
| | S-PHENYLMERCAPTURIC ACID Preparation Products And Raw materials |
|