|
|
| | 4-(Trifluoromethyl)cyclohexanecarboxylic acid Basic information |
| | 4-(Trifluoromethyl)cyclohexanecarboxylic acid Chemical Properties |
| Melting point | 71-75 °C(lit.) | | Boiling point | 230-231°C | | density | 1.292±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | form | powder to crystal | | pka | 4.60±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C8H11F3O2/c9-8(10,11)6-3-1-5(2-4-6)7(12)13/h5-6H,1-4H2,(H,12,13) | | InChIKey | LMEAZIIFLVDISW-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)CCC(C(F)(F)F)CC1 | | CAS DataBase Reference | 95233-30-0(CAS DataBase Reference) |
| Hazard Codes | Xn,C | | Risk Statements | 20/21/22-36/38 | | Safety Statements | 26-36/37-7/9 | | RIDADR | UN3261 | | WGK Germany | 3 | | HazardClass | CORROSIVE | | HS Code | 2916200090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 4-(Trifluoromethyl)cyclohexanecarboxylic acid Usage And Synthesis |
| | 4-(Trifluoromethyl)cyclohexanecarboxylic acid Preparation Products And Raw materials |
|