| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:3-Methoxycarbonylphenylboronic acid MIDA ester
Remarks:MR01040051
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3-Methoxycarbonylphenylboronic acid MIDA ester
Purity:97% Package:5G Remarks:698164-5G
|
| Company Name: |
Shanghai Sunway Pharmaceutical Technology Co.,Ltd.
|
| Tel: |
13611835272 13611835272 |
| Email: |
mmwang@sunwaypharm.com |
| Products Intro: |
Product Name:3-Methoxycarbonylphenylboronic acid mida ester
CAS:1356823-24-9
Purity:97% Package:0.1g;0.25g;1g;5g;10g;25g;100g;500g
|
| Company Name: |
Baoji Didu Pharmaceutical and Chemical Co., Ltd
|
| Tel: |
029-029-81148929 17792602132 |
| Email: |
1088@dideu.com |
| Products Intro: |
Product Name:3-Methoxycarbonylphenylboronic acid MIDA ester
CAS:1356823-24-9
Purity:97% Package:1kg;25kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3-Methoxycarbonylphenylboronic acid MIDA ester
|
|
| | Methyl 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl) benzoate Basic information |
| | Methyl 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl) benzoate Chemical Properties |
| Melting point | 265-270 °C | | form | powder | | InChI | 1S/C13H14BNO6/c1-15-7-11(16)20-14(21-12(17)8-15)10-5-3-4-9(6-10)13(18)19-2/h3-6H,7-8H2,1-2H3 | | InChIKey | CXKQXSCYYBJVTQ-UHFFFAOYSA-N | | SMILES | COC(=O)c1cccc(c1)B2OC(=O)CN(C)CC(=O)O2 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Methyl 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl) benzoate Usage And Synthesis |
| | Methyl 3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl) benzoate Preparation Products And Raw materials |
|