O-PHOSPHO-L-THREONINE manufacturers
- O-PHOSPHO-L-THREONINE
-
- $0.10 / 1KG
-
2025-12-24
- CAS:1114-81-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10
|
| | O-PHOSPHO-L-THREONINE Basic information |
| Product Name: | O-PHOSPHO-L-THREONINE | | Synonyms: | L-THREONINE O-PHOSPHATE;L-2-AMINO-3-HYDROXYBUTANOIC ACID 3-PHOSPHATE;H-THR(PO3H2)-OH;(s)-2-amino-3-hydroxybutanoic acid 3-phosphate;L-Threonine O-phosphate, (S)-2-Amino-3-hydroxybutanoic acid 3-phosphate;(2S,3R)-2-Amino-3-phosphonooxybutanoic acid;L-Threonine dihydrogen phosphate;O-Phosphothreonine | | CAS: | 1114-81-4 | | MF: | C4H10NO6P | | MW: | 199.1 | | EINECS: | 214-217-5 | | Product Categories: | | | Mol File: | 1114-81-4.mol |  |
| | O-PHOSPHO-L-THREONINE Chemical Properties |
| Melting point | 169 °C | | Boiling point | 454.0±55.0 °C(Predicted) | | density | 1.671±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | NH4OH 1 M: 0.1 g/mL, clear, colorless | | pka | 1.73±0.10(Predicted) | | form | A solid | | color | white | | Optical Rotation | -9.7°(C=0.01g/mI, H2O, 20°C, 589nm) | | BRN | 1727078 | | InChI | 1S/C4H10NO6P/c1-2(3(5)4(6)7)11-12(8,9)10/h2-3H,5H2,1H3,(H,6,7)(H2,8,9,10)/t2-,3+/m1/s1 | | InChIKey | USRGIUJOYOXOQJ-GBXIJSLDSA-N | | SMILES | C[C@@H](OP(O)(O)=O)[C@H](N)C(O)=O |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | O-PHOSPHO-L-THREONINE Usage And Synthesis |
| Uses | O-Phospho-L-threonine is a threonine derivative[1]. | | Definition | ChEBI: O-phospho-L-threonine is a L-threonine derivative phosphorylated at the side-chain hydroxy function. It has a role as an Escherichia coli metabolite. It is a L-threonine derivative, a non-proteinogenic L-alpha-amino acid and an O-phosphoamino acid. It is a conjugate acid of an O-phosphonato-L-threonine(2-). | | Biochem/physiol Actions | O-Phospho-L-threonine is an amino acid derivative. | | IC 50 | Human Endogenous Metabolite | | Purification Methods | Dissolve the phosphate in the minimum volume of H2O, add charcoal, stir for a few minutes, filter and apply onto a column of Dowex 50W (H+ form), then elute with 2N HCl. Evaporate the eluates under reduced pressure whereby the desired fraction produces crystals of the phosphate which can be recrystallised from H2O/MeOH mixtures and the crystals are then dried in vacuo over P2O5 at ~80o. [de Verdier Acta Chem Scand 7 196 1953, Beilstein 4 IV 3175.] | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | O-PHOSPHO-L-THREONINE Preparation Products And Raw materials |
|