| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde Basic information |
| Product Name: | 2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde | | Synonyms: | AKOS BB-7665;ASISCHEM B65315;3-Ethoxy-5,6-dibromosalicylaldehyde;5,6-Dibromo-o-bourbonal;Benzaldehyde, 2,3-dibromo-5-ethoxy-6-hydroxy-;3-Ethoxy-5,6-dibromosalicylaldehyde >=95% (HPLC);2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde | | CAS: | 20041-64-9 | | MF: | C9H8Br2O3 | | MW: | 323.97 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde Chemical Properties |
| Boiling point | 336.0±37.0 °C(Predicted) | | density | 1.879±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ≥15mg/mL | | form | powder | | pka | 6.79±0.28(Predicted) | | color | yellow | | InChI | 1S/C9H8Br2O3/c1-2-14-7-3-6(10)8(11)5(4-12)9(7)13/h3-4,13H,2H2,1H3 | | InChIKey | MZAISYPWQNBWED-UHFFFAOYSA-N | | SMILES | CCOc1cc(Br)c(Br)c(C=O)c1O |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde Usage And Synthesis |
| Uses | 3-Ethoxy-5,6-dibromosalicylaldehyde was used to study modulation of autophagy, JNK activation and NF-KB-mediated inflammation. | | Biological Activity | 3-Ethoxy-5,6-dibromosalicylaldehyde is a non-competitive inhibitor of Inositol-requiring enzyme 1 (IRE1). It inhibits XBP-1 splicing induced pharmacologically in human cells. 3-Ethoxy-5,6-dibromosalicylaldehyde potently inhibits the endoribonuclease of IRE1 but does not inhibit RNases A, T1, or L. |
| | 2,3-Dibromo-5-ethoxy-6-hydroxybenzaldehyde Preparation Products And Raw materials |
|