1,1,2,2-Tetra(4-methoxyphenyl)ethene manufacturers
|
| | 1,1,2,2-Tetra(4-methoxyphenyl)ethene Basic information |
| Product Name: | 1,1,2,2-Tetra(4-methoxyphenyl)ethene | | Synonyms: | 1,1,2,2-Tetra(4-methoxyphenyl)ethene;1,1,2,2-Tetrakis(4-methoxyphenyl)ethene;Tetrakis(4-methoxyphenyl)ethene;Tetrakis(4-methoxyphenyl)ethylene;1-methoxy-4-[1,2,2-tris(4-methoxyphenyl)ethenyl]benzene;1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy-Benzene;Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy-;1,1,2,2-tetrakis(4-methoxyphenyl)ethylene | | CAS: | 10019-24-6 | | MF: | C30H28O4 | | MW: | 452.54 | | EINECS: | | | Product Categories: | | | Mol File: | 10019-24-6.mol |  |
| | 1,1,2,2-Tetra(4-methoxyphenyl)ethene Chemical Properties |
| Melting point | 183 °C | | Boiling point | 574.1±45.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C30H28O4/c1-31-25-13-5-21(6-14-25)29(22-7-15-26(32-2)16-8-22)30(23-9-17-27(33-3)18-10-23)24-11-19-28(34-4)20-12-24/h5-20H,1-4H3 | | InChIKey | LXYBRRVOIQFRRL-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(OC)C=C1)(\C1=CC=C(OC)C=C1)=C(\C1=CC=C(OC)C=C1)/C1=CC=C(OC)C=C1 |
| | 1,1,2,2-Tetra(4-methoxyphenyl)ethene Usage And Synthesis |
| | 1,1,2,2-Tetra(4-methoxyphenyl)ethene Preparation Products And Raw materials |
|