|
|
| | Tetrakis(4-nitrophenyl)ethene Basic information |
| Product Name: | Tetrakis(4-nitrophenyl)ethene | | Synonyms: | 1,1,2,2-Tetrakis[4-nitrophenyl]ethene;Tetrakis(4-nitrophenyl)ethene;Tetrakis(p-nitrophenyl)ethylene;Tetrakis(4-nitrophenyl)ethylene;Tetrakis(4-nitrophenyl)ethane;benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-nitro-;JACS-47797-98-8;1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-nitro-benzene | | CAS: | 47797-98-8 | | MF: | C26H16N4O8 | | MW: | 512.43 | | EINECS: | | | Product Categories: | COF | | Mol File: | 47797-98-8.mol |  |
| | Tetrakis(4-nitrophenyl)ethene Chemical Properties |
| Melting point | 298-299 °C | | Boiling point | 577.4±45.0 °C(Predicted) | | density | 1.452±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C26H16N4O8/c31-27(32)21-9-1-17(2-10-21)25(18-3-11-22(12-4-18)28(33)34)26(19-5-13-23(14-6-19)29(35)36)20-7-15-24(16-8-20)30(37)38/h1-16H | | InChIKey | SZWJHJKAKYAICN-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C([N+]([O-])=O)C=C1)(\C1=CC=C([N+]([O-])=O)C=C1)=C(\C1=CC=C([N+]([O-])=O)C=C1)/C1=CC=C([N+]([O-])=O)C=C1 |
| | Tetrakis(4-nitrophenyl)ethene Usage And Synthesis |
| Purification Methods | Crystallise it from dioxane or AcOH (m 292o, yellow needles), and dry it at 150o/0.1mm. [Gorvin J Chem Soc 678 1959, Schlenk Justus Liebigs Ann Chem 394 214 1913, Beilstein 5 H 744, 5 IV 2780.] |
| | Tetrakis(4-nitrophenyl)ethene Preparation Products And Raw materials |
|