|
|
| | Phenylcarbamic acid propyl ester Basic information |
| Product Name: | Phenylcarbamic acid propyl ester | | Synonyms: | N-Phenylcarbamic acid propyl ester;Phenylcarbamic acid propyl ester;Propyl phenylurethane;Propyl phenylcarbamate ,98%;propyl phenylcarate;propyl phenylcarbamate;Carbamic acid, N-phenyl-, propyl ester;Propyl n-phenylcarbamate | | CAS: | 5532-90-1 | | MF: | C10H13NO2 | | MW: | 179.22 | | EINECS: | | | Product Categories: | | | Mol File: | 5532-90-1.mol |  |
| | Phenylcarbamic acid propyl ester Chemical Properties |
| Melting point | 57.85°C | | Boiling point | 311.75°C (rough estimate) | | density | 1.1248 (rough estimate) | | refractive index | 1.5150 (estimate) | | pka | 13.86±0.70(Predicted) | | InChI | InChI=1S/C10H13NO2/c1-2-8-13-10(12)11-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,11,12) | | InChIKey | QDZXCXBFZLLQFT-UHFFFAOYSA-N | | SMILES | C(OCCC)(=O)NC1=CC=CC=C1 |
| | Phenylcarbamic acid propyl ester Usage And Synthesis |
| | Phenylcarbamic acid propyl ester Preparation Products And Raw materials |
|