|
|
| | 2-Nitrophenylpyruvic acid Basic information |
| | 2-Nitrophenylpyruvic acid Chemical Properties |
| Melting point | 119-120 °C(lit.) | | Boiling point | 379.7±25.0 °C(Predicted) | | density | 1.469±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 2.30±0.54(Predicted) | | InChI | 1S/C9H7NO5/c11-8(9(12)13)5-6-3-1-2-4-7(6)10(14)15/h1-4H,5H2,(H,12,13) | | InChIKey | CGCWRLDEYHZQCW-UHFFFAOYSA-N | | SMILES | OC(=O)C(=O)Cc1ccccc1[N+]([O-])=O | | CAS DataBase Reference | 5461-32-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2-Nitrophenylpyruvic acid Usage And Synthesis |
| | 2-Nitrophenylpyruvic acid Preparation Products And Raw materials |
|