|
|
| | 1-Methyl-2-piperidinemethanol Basic information |
| | 1-Methyl-2-piperidinemethanol Chemical Properties |
| Boiling point | 79-80 °C/7 mmHg (lit.) | | density | 0.984 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4823(lit.) | | Fp | 178 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Methanol | | pka | 15.08±0.10(Predicted) | | form | Liquid | | color | Clear brown | | BRN | 103612 | | InChI | InChI=1S/C7H15NO/c1-8-5-3-2-4-7(8)6-9/h7,9H,2-6H2,1H3 | | InChIKey | HXXJMMLIEYAFOZ-UHFFFAOYSA-N | | SMILES | N1(C)CCCCC1CO | | CAS DataBase Reference | 20845-34-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Methyl-2-piperidinemethanol(20845-34-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29333999 |
| | 1-Methyl-2-piperidinemethanol Usage And Synthesis |
| Chemical Properties | CLEAR BROWN LIQUID | | Uses | 1-Methyl-2-piperidinemethanol can be used in the preparation of substances for treatment of dermatological conditions and skin protection. | | Uses | 1-Methyl-2-piperidinemethanol is used as a reagent to synthesize phenylpyridone derivatives, compounds that act as anti-obesity agents in mice. | | General Description | The standard molar energy of combustion of 1-Methyl-2-piperidinemethanol has been studied. |
| | 1-Methyl-2-piperidinemethanol Preparation Products And Raw materials |
|