|
|
| | 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine Basic information |
| Product Name: | 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine | | Synonyms: | 4-(3-bromo-4-fluorophenyl)-1,3-thiazol-2-amine;2-Thiazolamine, 4-(3-bromo-4-fluorophenyl)-;4-(3-Bromo-4-fluorophenyl)thiazol-2(3h)-imine;4-(3-Bromo-4-fluorophenyl)-1,3-thiazol-2-ylamine;4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine | | CAS: | 676348-24-6 | | MF: | C9H6BrFN2S | | MW: | 273.12 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine Chemical Properties |
| Boiling point | 390.9±27.0 °C(Predicted) | | density | 1.705±0.06 g/cm3(Predicted) | | pka | 3.48±0.10(Predicted) | | InChI | 1S/C9H6BrFN2S/c10-6-3-5(1-2-7(6)11)8-4-14-9(12)13-8/h1-4H,(H2,12,13) | | InChIKey | DUJCJNOITOUHLQ-UHFFFAOYSA-N | | SMILES | Fc1c(cc(cc1)c2nc([s]c2)N)Br |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine Usage And Synthesis |
| | 4-(3-Bromo-4-fluorophenyl)thiazol-2-ylamine Preparation Products And Raw materials |
|