- 9-Carboxyfluorene
-
- $0.00 / 1KG
-
2026-01-28
- CAS:1989-33-9
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 9-Carboxyfluorene
-
- $80.00 / 1kg
-
2023-09-11
- CAS:1989-33-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000tons
- 9-Carboxyfluorene
-
- $1.00 / 1kg
-
2019-07-06
- CAS:1989-33-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: Customized
|
| | 9-Carboxyfluorene Basic information |
| | 9-Carboxyfluorene Chemical Properties |
| Melting point | 228-231 °C(lit.) | | Boiling point | 309.75°C (rough estimate) | | density | 1.1307 (rough estimate) | | refractive index | 1.5681 (estimate) | | Fp | 230°C | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.59±0.20(Predicted) | | form | powder | | color | Faint beige | | Water Solubility | insoluble | | BRN | 1911728 | | InChI | InChI=1S/C14H10O2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H,(H,15,16) | | InChIKey | DNVJGJUGFFYUPT-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)C2=C(C=CC=C2)C2=C1C=CC=C2 | | CAS DataBase Reference | 1989-33-9(CAS DataBase Reference) | | NIST Chemistry Reference | 9H-fluorene-9-carboxylic acid(1989-33-9) | | EPA Substance Registry System | 9H-Fluorene-9-carboxylic acid (1989-33-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37/39-27-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | 9-Carboxyfluorene Usage And Synthesis |
| Chemical Properties | WHITE TO YELLOW CRYSTALLINE POWDER | | Uses | 9H-Fluorene-9-carboxylic Acid, is a building block in the synthesis of various pharmaceutical and biologically active compounds. It is used in the synthesis of Lomitapide, a drug for the treatment of familial hypercholesterolemia. |
| | 9-Carboxyfluorene Preparation Products And Raw materials |
|