Boc-D-Lys(Boc)-Onp manufacturers
- Boc-Lys(Boc)-ONp
-
- $9.80 / 1KG
-
2020-01-10
- CAS:2592-19-0
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Boc-D-Lys(Boc)-Onp Basic information |
| Product Name: | Boc-D-Lys(Boc)-Onp | | Synonyms: | BOC-LYSINE(BOC)-ONP;BOC-LYS(BOC)-ONP;N-ALPHA, N-EPSILON-DI-BOC-L-LYSINE P-NITROPHENYL ESTER;N-ALPHA, N-EPSILON-DI-BOC-L-LYSINE 4-NITROPHENYL ESTER;N-ALPHA,EPSILON-BIS-BOC-L-LYSINE 4-NITROPHENYL ESTER;4-nitrophenyl N2,N6-bis[(1,1-dimethylethoxy)carbonyl]-L-lysinate;Boc-L-Lys(Boc)-ONp;N-alpha-N-epsilon-di-t-Butyloxycarbonyl-L-lysine p-nitrophenyl ester | | CAS: | 2592-19-0 | | MF: | C22H33N3O8 | | MW: | 467.51 | | EINECS: | 219-988-1 | | Product Categories: | Lysine [Lys, K];Amino Acids | | Mol File: | 2592-19-0.mol |  |
| | Boc-D-Lys(Boc)-Onp Chemical Properties |
| Boiling point | 617.0±55.0 °C(Predicted) | | density | 1.183 | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 10.82±0.46(Predicted) | | form | Powder | | InChIKey | LYUXBTAUKJETMS-KRWDZBQOSA-N | | SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)[C@H](CCCCNC(OC(C)(C)C)=O)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 2592-19-0(CAS DataBase Reference) |
| | Boc-D-Lys(Boc)-Onp Usage And Synthesis |
| Chemical Properties | Light yellowish crystalline powder | | Uses | Nα,Nε-DiBoc-L-lysine p-Nitrophenol Ester is an antibody-drug conjugate and antitumor agent. |
| | Boc-D-Lys(Boc)-Onp Preparation Products And Raw materials |
|